6-METHYLPYRIDIN-2-YL-2-BORONIC ACID

6-METHYLPYRIDIN-2-YL-2-BORONIC ACID - Names and Identifiers

Name	6-Methylpyridine-2-boronic acid
Synonyms	6-PICOLINE-2-BORONIC ACID 2-Borono-6-methylpyridine 6-methyl-2-pyridylboronic acid 6-METHYLPYRIDINE-2-BORONIC ACID 6-Methyl-2-pyridineboronic acid 6-Methylpyridine-2-boronic acid (6-Methylpyridin-2-yl)boronic acid 6-METHYLPYRIDIN-2-YL-2-BORONIC ACID boronic acid, B-(6-methyl-2-pyridinyl)- 6-Methylpyridine-2-boronic acid,mono-lithium salt
CAS	372963-50-3
EINECS	251-156-6
InChI	InChI=1/C6H8BNO2/c1-5-3-2-4-6(8-5)7(9)10/h2-4,9-10H,1H3

6-METHYLPYRIDIN-2-YL-2-BORONIC ACID - Physico-chemical Properties

Molecular Formula	C6H8BNO2
Molar Mass	136.94
Density	1.18±0.1 g/cm3(Predicted)
Boling Point	311.2±44.0 °C(Predicted)
Flash Point	142°C
Vapor Presure	0.000245mmHg at 25°C
pKa	7.89±0.53(Predicted)
Storage Condition	Inert atmosphere,Store in freezer, under -20°C
Refractive Index	1.527

6-METHYLPYRIDIN-2-YL-2-BORONIC ACID - Introduction

6-Methylpyridine-2-boronic acid is an organic compound with the chemical formula C6H8BNO2.

Its properties include:
1. Appearance: white crystalline powder;
2. melting point: about 120 ℃;
3. solubility: soluble in common organic solvents such as ethanol, acetone, insoluble in water.

6-Methylpyridine-2-boronic acid is widely used as a boronating reagent and catalyst in chemical synthesis. Its main uses include:
1. Boron ligand: as an uncatalyzed thiolation reagent for olefins and aromatic compounds;
2. Catalyst: It is used as a ligand in metal-catalyzed synthesis reactions and participates in important cross-coupling reactions such as hydrocarbon functionalization, aromatic substitution, and Suzuki-Miyaura.

6-Methylpyridine-2-boronic acid can be prepared by the following steps:
1. 6-methylpyridine reacts with boric acid to generate 6-Methylpyridine-2-boronic acid.

About its safety information:
1. During storage and operation of 6-Methylpyridine-2-boronic acid, avoid contact with skin, eyes and mucous membranes;
2. use to wear chemical protective gloves, goggles and protective clothing and other personal protective equipment;
3. in case of accidental contact, rinse immediately with plenty of water and consult a doctor;
4. During use and storage, it is necessary to maintain a well-ventilated condition.

Last Update：2024-04-10 22:29:15